C11H18F2N2O — CID 176757664
N-tert-butyl-2-[(3,3-difluoroazetidin-1-yl)methyl]prop-2-enamide (PubChem CID 176757664) has the molecular formula C11H18F2N2O and a molecular weight of 232.27 g/mol. Its IUPAC name is N-tert-butyl-2-[(3,3-difluoroazetidin-1-yl)methyl]prop-2-enamide.
| Compound Name | N-tert-butyl-2-[(3,3-difluoroazetidin-1-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 176757664 |
| Molecular Formula | C11H18F2N2O |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N-tert-butyl-2-[(3,3-difluoroazetidin-1-yl)methyl]prop-2-enamide |
| SMILES | C=C(CN1CC(F)(F)C1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H18F2N2O/c1-8(9(16)14-10(2,3)4)5-15-6-11(12,13)7-15/h1,5-7H2,2-4H3,(H,14,16) |
| InChIKey | MBDLGBLUMKRQHW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|