C9H16F2N2O — CID 177014891
2-[(3,3-difluoroazetidin-1-yl)methyl]prop-2-enamide;ethane (PubChem CID 177014891) has the molecular formula C9H16F2N2O and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-[(3,3-difluoroazetidin-1-yl)methyl]prop-2-enamide;ethane.
| Compound Name | 2-[(3,3-difluoroazetidin-1-yl)methyl]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 177014891 |
| Molecular Formula | C9H16F2N2O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-[(3,3-difluoroazetidin-1-yl)methyl]prop-2-enamide;ethane |
| SMILES | C=C(CN1CC(F)(F)C1)C(N)=O.CC |
| InChI | InChI=1S/C7H10F2N2O.C2H6/c1-5(6(10)12)2-11-3-7(8,9)4-11;1-2/h1-4H2,(H2,10,12);1-2H3 |
| InChIKey | WWBPUFWOCPJNFD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|