C8H13F3N2O — CID 172624010
N-methyl-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-enamide (PubChem CID 172624010) has the molecular formula C8H13F3N2O and a molecular weight of 210.20 g/mol. Its IUPAC name is N-methyl-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-enamide.
| Compound Name | N-methyl-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 172624010 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | N-methyl-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-enamide |
| SMILES | C=C(CN(C)CC(F)(F)F)C(=O)NC |
| InChI | InChI=1S/C8H13F3N2O/c1-6(7(14)12-2)4-13(3)5-8(9,10)11/h1,4-5H2,2-3H3,(H,12,14) |
| InChIKey | DYXVSBWUSGVJHX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|