C9H15FN2O — CID 172623971
2-[(3-fluoro-3-methylazetidin-1-yl)methyl]-N-methylprop-2-enamide (PubChem CID 172623971) has the molecular formula C9H15FN2O and a molecular weight of 186.23 g/mol. Its IUPAC name is 2-[(3-fluoro-3-methylazetidin-1-yl)methyl]-N-methylprop-2-enamide.
| Compound Name | 2-[(3-fluoro-3-methylazetidin-1-yl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 172623971 |
| Molecular Formula | C9H15FN2O |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-[(3-fluoro-3-methylazetidin-1-yl)methyl]-N-methylprop-2-enamide |
| SMILES | C=C(CN1CC(C)(F)C1)C(=O)NC |
| InChI | InChI=1S/C9H15FN2O/c1-7(8(13)11-3)4-12-5-9(2,10)6-12/h1,4-6H2,2-3H3,(H,11,13) |
| InChIKey | VANCDPUSYHCDKC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|