C9H14F2N2O — CID 177013656
2-[(3,3-difluoropyrrolidin-1-yl)methyl]-N-methylprop-2-enamide (PubChem CID 177013656) has the molecular formula C9H14F2N2O and a molecular weight of 204.22 g/mol. Its IUPAC name is 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-N-methylprop-2-enamide.
| Compound Name | 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 177013656 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-N-methylprop-2-enamide |
| SMILES | C=C(CN1CCC(F)(F)C1)C(=O)NC |
| InChI | InChI=1S/C9H14F2N2O/c1-7(8(14)12-2)5-13-4-3-9(10,11)6-13/h1,3-6H2,2H3,(H,12,14) |
| InChIKey | SNUBPXAVQKRANM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|