C11H15F5N2O — CID 102304835
N-[2-fluoro-2-(2,3,4,5-tetrafluoropyrrolidin-1-yl)propyl]-2-methylprop-2-enamide (PubChem CID 102304835) has the molecular formula C11H15F5N2O and a molecular weight of 286.24 g/mol. Its IUPAC name is N-[2-fluoro-2-(2,3,4,5-tetrafluoropyrrolidin-1-yl)propyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-fluoro-2-(2,3,4,5-tetrafluoropyrrolidin-1-yl)propyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 102304835 |
| Molecular Formula | C11H15F5N2O |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-[2-fluoro-2-(2,3,4,5-tetrafluoropyrrolidin-1-yl)propyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCC(C)(F)N1C(F)C(F)C(F)C1F |
| InChI | InChI=1S/C11H15F5N2O/c1-5(2)10(19)17-4-11(3,16)18-8(14)6(12)7(13)9(18)15/h6-9H,1,4H2,2-3H3,(H,17,19) |
| InChIKey | CHSGEFWUQCADLN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|