C8H15N3O — CID 142661562
1-(3,4-diaminopyrrolidin-1-yl)-2-methylprop-2-en-1-one (PubChem CID 142661562) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 1-(3,4-diaminopyrrolidin-1-yl)-2-methylprop-2-en-1-one.
| Compound Name | 1-(3,4-diaminopyrrolidin-1-yl)-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 142661562 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 1-(3,4-diaminopyrrolidin-1-yl)-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1CC(N)C(N)C1 |
| InChI | InChI=1S/C8H15N3O/c1-5(2)8(12)11-3-6(9)7(10)4-11/h6-7H,1,3-4,9-10H2,2H3 |
| InChIKey | CVDOVDNIZHUCSH-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|