C10H15N3S — CID 116680460
2-(azetidin-3-ylidene)-N-(1,3-thiazol-5-ylmethyl)propan-1-amine (PubChem CID 116680460) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 2-(azetidin-3-ylidene)-N-(1,3-thiazol-5-ylmethyl)propan-1-amine.
| Compound Name | 2-(azetidin-3-ylidene)-N-(1,3-thiazol-5-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 116680460 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-(azetidin-3-ylidene)-N-(1,3-thiazol-5-ylmethyl)propan-1-amine |
| SMILES | CC(CNCc1cncs1)=C1CNC1 |
| InChI | InChI=1S/C10H15N3S/c1-8(9-3-12-4-9)2-11-5-10-6-13-7-14-10/h6-7,11-12H,2-5H2,1H3 |
| InChIKey | MOJCGZFEFFCHAB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|