C11H20N2 — CID 116680409
2-(azetidin-3-ylidene)-N-[(2-methylcyclopropyl)methyl]propan-1-amine (PubChem CID 116680409) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-(azetidin-3-ylidene)-N-[(2-methylcyclopropyl)methyl]propan-1-amine.
| Compound Name | 2-(azetidin-3-ylidene)-N-[(2-methylcyclopropyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 116680409 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2-(azetidin-3-ylidene)-N-[(2-methylcyclopropyl)methyl]propan-1-amine |
| SMILES | CC(CNCC1CC1C)=C1CNC1 |
| InChI | InChI=1S/C11H20N2/c1-8-3-10(8)5-12-4-9(2)11-6-13-7-11/h8,10,12-13H,3-7H2,1-2H3 |
| InChIKey | PCHDZYXOWMYIMW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|