C15H19F5N6O — CID 11668347
(3,3-difluoropyrrolidin-1-yl)-[(2S,4S)-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pyrrolidin-2-yl]methanone (PubChem CID 11668347) has the molecular formula C15H19F5N6O and a molecular weight of 394.35 g/mol. Its IUPAC name is (3,3-difluoropyrrolidin-1-yl)-[(2S,4S)-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pyrrolidin-2-yl]methanone.
| Compound Name | (3,3-difluoropyrrolidin-1-yl)-[(2S,4S)-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 11668347 |
| Molecular Formula | C15H19F5N6O |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (3,3-difluoropyrrolidin-1-yl)-[(2S,4S)-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pyrrolidin-2-yl]methanone |
| SMILES | O=C([C@@H]1C[C@H](N2CCn3c(nnc3C(F)(F)F)C2)CN1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C15H19F5N6O/c16-14(17)1-2-25(8-14)12(27)10-5-9(6-21-10)24-3-4-26-11(7-24)22-23-13(26)15(18,19)20/h9-10,21H,1-8H2/t9-,10-/m0/s1 |
| InChIKey | QFPFLPBDSOBQKS-UWVGGRQHSA-N |
| XLogP | 0.71 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |