C15H22FNO — CID 116685626
1-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidin-2-yl)ethanol (PubChem CID 116685626) has the molecular formula C15H22FNO and a molecular weight of 251.34 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidin-2-yl)ethanol.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidin-2-yl)ethanol |
|---|---|
| PubChem CID | 116685626 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidin-2-yl)ethanol |
| SMILES | Cc1ccc(C(O)CC2CC(C)CCN2)cc1F |
| InChI | InChI=1S/C15H22FNO/c1-10-5-6-17-13(7-10)9-15(18)12-4-3-11(2)14(16)8-12/h3-4,8,10,13,15,17-18H,5-7,9H2,1-2H3 |
| InChIKey | IHBXKCKVNGLJOG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |