C26H30FNO2 — CID 11668641
10-cyclopropyl-9-(4-fluorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 11668641) has the molecular formula C26H30FNO2 and a molecular weight of 407.53 g/mol. Its IUPAC name is 10-cyclopropyl-9-(4-fluorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-cyclopropyl-9-(4-fluorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 11668641 |
| Molecular Formula | C26H30FNO2 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 10-cyclopropyl-9-(4-fluorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(C1CC1)C1=C(C(=O)CC(C)(C)C1)C2c1ccc(F)cc1 |
| InChI | InChI=1S/C26H30FNO2/c1-25(2)11-18-23(20(29)13-25)22(15-5-7-16(27)8-6-15)24-19(28(18)17-9-10-17)12-26(3,4)14-21(24)30/h5-8,17,22H,9-14H2,1-4H3 |
| InChIKey | SRDPPSSVFIKRGT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |