About tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate
tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate (PubChem CID 116687098) has the molecular formula C16H21NO3S
and a molecular weight of 307.42 g/mol. Its IUPAC name is tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate |
| PubChem CID | 116687098 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate |
| SMILES | Cc1oc(C)c(-c2cc(N)c(C(=O)OC(C)(C)C)s2)c1C |
| InChI | InChI=1S/C16H21NO3S/c1-8-9(2)19-10(3)13(8)12-7-11(17)14(21-12)15(18)20-16(4,5)6/h7H,17H2,1-6H3 |
| InChIKey | PRYXRMGCQSAXKA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate?
The IUPAC name of tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate (CID 116687098) is tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate.
What is the SMILES notation for tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate?
The canonical SMILES for tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate is Cc1oc(C)c(-c2cc(N)c(C(=O)OC(C)(C)C)s2)c1C.
What is the InChIKey of tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate?
The InChIKey is PRYXRMGCQSAXKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3S/c1-8-9(2)19-10(3)13(8)12-7-11(17)14(21-12)15(18)20-16(4,5)6/h7H,17H2,1-6H3.
What are the key properties of tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate?
tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate has a molecular weight of 307.42 g/mol, XLogP of 4.47, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-amino-5-(2,4,5-trimethylfuran-3-yl)thiophene-2-carboxylate is sourced from PubChem (CID 116687098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).