C16H20N2O3 — CID 116691430
2-[(3,4-dimethylcyclohexyl)amino]-1,3-benzoxazole-6-carboxylic acid (PubChem CID 116691430) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(3,4-dimethylcyclohexyl)amino]-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-[(3,4-dimethylcyclohexyl)amino]-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 116691430 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[(3,4-dimethylcyclohexyl)amino]-1,3-benzoxazole-6-carboxylic acid |
| SMILES | CC1CCC(Nc2nc3ccc(C(=O)O)cc3o2)CC1C |
| InChI | InChI=1S/C16H20N2O3/c1-9-3-5-12(7-10(9)2)17-16-18-13-6-4-11(15(19)20)8-14(13)21-16/h4,6,8-10,12H,3,5,7H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | KNIPQVQSAWTGAP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |