C13H14N2O5S — CID 116690777
2-[(1,1-dioxothian-4-yl)amino]-1,3-benzoxazole-6-carboxylic acid (PubChem CID 116690777) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)amino]-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-[(1,1-dioxothian-4-yl)amino]-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 116690777 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)amino]-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(NC3CCS(=O)(=O)CC3)oc2c1 |
| InChI | InChI=1S/C13H14N2O5S/c16-12(17)8-1-2-10-11(7-8)20-13(15-10)14-9-3-5-21(18,19)6-4-9/h1-2,7,9H,3-6H2,(H,14,15)(H,16,17) |
| InChIKey | LFSPVYPPSKKEOO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |