C13H14N2O5 — CID 116690808
2-(1,4-dioxan-2-ylmethylamino)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 116690808) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-ylmethylamino)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(1,4-dioxan-2-ylmethylamino)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 116690808 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(1,4-dioxan-2-ylmethylamino)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(NCC3COCCO3)oc2c1 |
| InChI | InChI=1S/C13H14N2O5/c16-12(17)8-1-2-10-11(5-8)20-13(15-10)14-6-9-7-18-3-4-19-9/h1-2,5,9H,3-4,6-7H2,(H,14,15)(H,16,17) |
| InChIKey | RJOMHEFVSQKBBV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |