C12H11NO2S — CID 116691933
3-(3-oxo-3-phenylpropyl)-1,3-thiazol-2-one (PubChem CID 116691933) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 3-(3-oxo-3-phenylpropyl)-1,3-thiazol-2-one.
| Compound Name | 3-(3-oxo-3-phenylpropyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 116691933 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 3-(3-oxo-3-phenylpropyl)-1,3-thiazol-2-one |
| SMILES | O=C(CCn1ccsc1=O)c1ccccc1 |
| InChI | InChI=1S/C12H11NO2S/c14-11(10-4-2-1-3-5-10)6-7-13-8-9-16-12(13)15/h1-5,8-9H,6-7H2 |
| InChIKey | IFPRPGAPALYANR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |