C11H8BrNO2S — CID 63312655
3-[2-(2-bromophenyl)-2-oxoethyl]-1,3-thiazol-2-one (PubChem CID 63312655) has the molecular formula C11H8BrNO2S and a molecular weight of 298.16 g/mol. Its IUPAC name is 3-[2-(2-bromophenyl)-2-oxoethyl]-1,3-thiazol-2-one.
| Compound Name | 3-[2-(2-bromophenyl)-2-oxoethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 63312655 |
| Molecular Formula | C11H8BrNO2S |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 296.95 |
| IUPAC Name | 3-[2-(2-bromophenyl)-2-oxoethyl]-1,3-thiazol-2-one |
| SMILES | O=C(Cn1ccsc1=O)c1ccccc1Br |
| InChI | InChI=1S/C11H8BrNO2S/c12-9-4-2-1-3-8(9)10(14)7-13-5-6-16-11(13)15/h1-6H,7H2 |
| InChIKey | MVDORPOTXJODAH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |