C11H7F2NO2S — CID 55205415
3-[2-(2,4-difluorophenyl)-2-oxoethyl]-1,3-thiazol-2-one (PubChem CID 55205415) has the molecular formula C11H7F2NO2S and a molecular weight of 255.25 g/mol. Its IUPAC name is 3-[2-(2,4-difluorophenyl)-2-oxoethyl]-1,3-thiazol-2-one.
| Compound Name | 3-[2-(2,4-difluorophenyl)-2-oxoethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 55205415 |
| Molecular Formula | C11H7F2NO2S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 3-[2-(2,4-difluorophenyl)-2-oxoethyl]-1,3-thiazol-2-one |
| SMILES | O=C(Cn1ccsc1=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H7F2NO2S/c12-7-1-2-8(9(13)5-7)10(15)6-14-3-4-17-11(14)16/h1-5H,6H2 |
| InChIKey | GFFYCKOYOVKBSA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |