C13H9F3N2O2S — CID 824469
2,2,2-trifluoro-N-(3-phenacyl-1,3-thiazol-2-ylidene)acetamide (PubChem CID 824469) has the molecular formula C13H9F3N2O2S and a molecular weight of 314.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(3-phenacyl-1,3-thiazol-2-ylidene)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(3-phenacyl-1,3-thiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 824469 |
| Molecular Formula | C13H9F3N2O2S |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2,2,2-trifluoro-N-(3-phenacyl-1,3-thiazol-2-ylidene)acetamide |
| SMILES | O=C(Cn1ccs/c1=N\C(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H9F3N2O2S/c14-13(15,16)11(20)17-12-18(6-7-21-12)8-10(19)9-4-2-1-3-5-9/h1-7H,8H2/b17-12- |
| InChIKey | WPGKHJAEQXWLAZ-ATVHPVEESA-N |
| XLogP | 2.42 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |