C13H13FN2O2S — CID 126477131
N-[3-[2-(4-fluorophenyl)-2-oxoethyl]-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 126477131) has the molecular formula C13H13FN2O2S and a molecular weight of 280.32 g/mol. Its IUPAC name is N-[3-[2-(4-fluorophenyl)-2-oxoethyl]-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | N-[3-[2-(4-fluorophenyl)-2-oxoethyl]-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 126477131 |
| Molecular Formula | C13H13FN2O2S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-[3-[2-(4-fluorophenyl)-2-oxoethyl]-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | CC(=O)/N=C1\SCCN1CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H13FN2O2S/c1-9(17)15-13-16(6-7-19-13)8-12(18)10-2-4-11(14)5-3-10/h2-5H,6-8H2,1H3/b15-13- |
| InChIKey | YOGUOVALELIASU-SQFISAMPSA-N |
| XLogP | 1.96 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|