C14H13F3N2O2S — CID 5011011
N-[3-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 5011011) has the molecular formula C14H13F3N2O2S and a molecular weight of 330.33 g/mol. Its IUPAC name is N-[3-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | N-[3-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 5011011 |
| Molecular Formula | C14H13F3N2O2S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N-[3-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | CC(=O)/N=C1\SCCN1CC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13F3N2O2S/c1-9(20)18-13-19(5-6-22-13)8-12(21)10-3-2-4-11(7-10)14(15,16)17/h2-4,7H,5-6,8H2,1H3/b18-13- |
| InChIKey | HIWNOBAJWPNDJU-AQTBWJFISA-N |
| XLogP | 2.84 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|