C17H25N3O — CID 116692484
2-amino-4-[ethyl(oxolan-2-ylmethyl)amino]-2-phenylbutanenitrile (PubChem CID 116692484) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-amino-4-[ethyl(oxolan-2-ylmethyl)amino]-2-phenylbutanenitrile.
| Compound Name | 2-amino-4-[ethyl(oxolan-2-ylmethyl)amino]-2-phenylbutanenitrile |
|---|---|
| PubChem CID | 116692484 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-amino-4-[ethyl(oxolan-2-ylmethyl)amino]-2-phenylbutanenitrile |
| SMILES | CCN(CCC(N)(C#N)c1ccccc1)CC1CCCO1 |
| InChI | InChI=1S/C17H25N3O/c1-2-20(13-16-9-6-12-21-16)11-10-17(19,14-18)15-7-4-3-5-8-15/h3-5,7-8,16H,2,6,9-13,19H2,1H3 |
| InChIKey | JCTMPGJVUDHRFM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |