C15H21N3O — CID 116695380
2-(methylamino)-4-(5-methylpyrazol-1-yl)-2-phenylbutan-1-ol (PubChem CID 116695380) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(methylamino)-4-(5-methylpyrazol-1-yl)-2-phenylbutan-1-ol.
| Compound Name | 2-(methylamino)-4-(5-methylpyrazol-1-yl)-2-phenylbutan-1-ol |
|---|---|
| PubChem CID | 116695380 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-(methylamino)-4-(5-methylpyrazol-1-yl)-2-phenylbutan-1-ol |
| SMILES | CNC(CO)(CCn1nccc1C)c1ccccc1 |
| InChI | InChI=1S/C15H21N3O/c1-13-8-10-17-18(13)11-9-15(12-19,16-2)14-6-4-3-5-7-14/h3-8,10,16,19H,9,11-12H2,1-2H3 |
| InChIKey | HOVQQSLEFJCGHT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |