C16H17Cl2NOS — CID 116695631
2-amino-4-(2,5-dichlorophenyl)sulfanyl-2-phenylbutan-1-ol (PubChem CID 116695631) has the molecular formula C16H17Cl2NOS and a molecular weight of 342.29 g/mol. Its IUPAC name is 2-amino-4-(2,5-dichlorophenyl)sulfanyl-2-phenylbutan-1-ol.
| Compound Name | 2-amino-4-(2,5-dichlorophenyl)sulfanyl-2-phenylbutan-1-ol |
|---|---|
| PubChem CID | 116695631 |
| Molecular Formula | C16H17Cl2NOS |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-amino-4-(2,5-dichlorophenyl)sulfanyl-2-phenylbutan-1-ol |
| SMILES | NC(CO)(CCSc1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H17Cl2NOS/c17-13-6-7-14(18)15(10-13)21-9-8-16(19,11-20)12-4-2-1-3-5-12/h1-7,10,20H,8-9,11,19H2 |
| InChIKey | UHURDSMEZGJWBU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |