About tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate
tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate (PubChem CID 11669938) has the molecular formula C25H42NO3PS
and a molecular weight of 467.66 g/mol. Its IUPAC name is tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate |
| PubChem CID | 11669938 |
| Molecular Formula | C25H42NO3PS |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCOP(=S)(CC1CN(C(=O)OC(C)(C)C)CC1C)c1ccccc1 |
| InChI | InChI=1S/C25H42NO3PS/c1-6-7-8-9-10-14-17-28-30(31,23-15-12-11-13-16-23)20-22-19-26(18-21(22)2)24(27)29-25(3,4)5/h11-13,15-16,21-22H,6-10,14,17-20H2,1-5H3 |
| InChIKey | CMEBTDXEQMPQSQ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate (CID 11669938) is tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate is CCCCCCCCOP(=S)(CC1CN(C(=O)OC(C)(C)C)CC1C)c1ccccc1.
What is the InChIKey of tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate?
The InChIKey is CMEBTDXEQMPQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H42NO3PS/c1-6-7-8-9-10-14-17-28-30(31,23-15-12-11-13-16-23)20-22-19-26(18-21(22)2)24(27)29-25(3,4)5/h11-13,15-16,21-22H,6-10,14,17-20H2,1-5H3.
What are the key properties of tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate?
tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate has a molecular weight of 467.66 g/mol, XLogP of 6.59, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-methyl-4-[[octoxy(phenyl)phosphinothioyl]methyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 11669938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).