C23H30NO2PS — CID 11654575
tert-butyl (3R,4S)-3-(diphenylphosphinothioylmethyl)-4-methylpyrrolidine-1-carboxylate (PubChem CID 11654575) has the molecular formula C23H30NO2PS and a molecular weight of 415.54 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-(diphenylphosphinothioylmethyl)-4-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-(diphenylphosphinothioylmethyl)-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11654575 |
| Molecular Formula | C23H30NO2PS |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | tert-butyl (3R,4S)-3-(diphenylphosphinothioylmethyl)-4-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@@H]1CP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30NO2PS/c1-18-15-24(22(25)26-23(2,3)4)16-19(18)17-27(28,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,18-19H,15-17H2,1-4H3/t18-,19-/m1/s1 |
| InChIKey | FCOQVEOHKWZITH-RTBURBONSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|