C15H18ClF3N2 — CID 116700846
8-[3-chloro-5-(trifluoromethyl)phenyl]-N-methyl-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 116700846) has the molecular formula C15H18ClF3N2 and a molecular weight of 318.77 g/mol. Its IUPAC name is 8-[3-chloro-5-(trifluoromethyl)phenyl]-N-methyl-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | 8-[3-chloro-5-(trifluoromethyl)phenyl]-N-methyl-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 116700846 |
| Molecular Formula | C15H18ClF3N2 |
| Molecular Weight | 318.77 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 8-[3-chloro-5-(trifluoromethyl)phenyl]-N-methyl-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CNC1CC2CCC(C1)N2c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18ClF3N2/c1-20-11-7-12-2-3-13(8-11)21(12)14-5-9(15(17,18)19)4-10(16)6-14/h4-6,11-13,20H,2-3,7-8H2,1H3 |
| InChIKey | AHYBWTLAHXIBJP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.77 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |