C15H29N3O2 — CID 116702190
6-[3-(1-ethoxybutyl)-1,2,4-oxadiazol-5-yl]heptan-2-amine (PubChem CID 116702190) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 6-[3-(1-ethoxybutyl)-1,2,4-oxadiazol-5-yl]heptan-2-amine.
| Compound Name | 6-[3-(1-ethoxybutyl)-1,2,4-oxadiazol-5-yl]heptan-2-amine |
|---|---|
| PubChem CID | 116702190 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 6-[3-(1-ethoxybutyl)-1,2,4-oxadiazol-5-yl]heptan-2-amine |
| SMILES | CCCC(OCC)c1noc(C(C)CCCC(C)N)n1 |
| InChI | InChI=1S/C15H29N3O2/c1-5-8-13(19-6-2)14-17-15(20-18-14)11(3)9-7-10-12(4)16/h11-13H,5-10,16H2,1-4H3 |
| InChIKey | RZIJJHBJQWMRCM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |