C9H16N2O3 — CID 116732822
[3-(1-ethoxybutyl)-1,2,4-oxadiazol-5-yl]methanol (PubChem CID 116732822) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is [3-(1-ethoxybutyl)-1,2,4-oxadiazol-5-yl]methanol.
| Compound Name | [3-(1-ethoxybutyl)-1,2,4-oxadiazol-5-yl]methanol |
|---|---|
| PubChem CID | 116732822 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | [3-(1-ethoxybutyl)-1,2,4-oxadiazol-5-yl]methanol |
| SMILES | CCCC(OCC)c1noc(CO)n1 |
| InChI | InChI=1S/C9H16N2O3/c1-3-5-7(13-4-2)9-10-8(6-12)14-11-9/h7,12H,3-6H2,1-2H3 |
| InChIKey | MBZSTABGBYUPOG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |