C13H16N4O4 — CID 116702670
2-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]-4-nitroaniline (PubChem CID 116702670) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]-4-nitroaniline.
| Compound Name | 2-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]-4-nitroaniline |
|---|---|
| PubChem CID | 116702670 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]-4-nitroaniline |
| SMILES | CCCC(OC)c1noc(-c2cc([N+](=O)[O-])ccc2N)n1 |
| InChI | InChI=1S/C13H16N4O4/c1-3-4-11(20-2)12-15-13(21-16-12)9-7-8(17(18)19)5-6-10(9)14/h5-7,11H,3-4,14H2,1-2H3 |
| InChIKey | FVGGLHXXWPQCCS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|