C11H12N4O4 — CID 61412440
2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-nitroaniline (PubChem CID 61412440) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-nitroaniline.
| Compound Name | 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-nitroaniline |
|---|---|
| PubChem CID | 61412440 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-nitroaniline |
| SMILES | COCCc1noc(-c2cc([N+](=O)[O-])ccc2N)n1 |
| InChI | InChI=1S/C11H12N4O4/c1-18-5-4-10-13-11(19-14-10)8-6-7(15(16)17)2-3-9(8)12/h2-3,6H,4-5,12H2,1H3 |
| InChIKey | UNEFTFQXQDDBNP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|