C10H14ClNOS — CID 116705113
4-(chloromethyl)-2-[cyclopropyl(ethoxy)methyl]-1,3-thiazole (PubChem CID 116705113) has the molecular formula C10H14ClNOS and a molecular weight of 231.75 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[cyclopropyl(ethoxy)methyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[cyclopropyl(ethoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 116705113 |
| Molecular Formula | C10H14ClNOS |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-(chloromethyl)-2-[cyclopropyl(ethoxy)methyl]-1,3-thiazole |
| SMILES | CCOC(c1nc(CCl)cs1)C1CC1 |
| InChI | InChI=1S/C10H14ClNOS/c1-2-13-9(7-3-4-7)10-12-8(5-11)6-14-10/h6-7,9H,2-5H2,1H3 |
| InChIKey | YNSNKXJNZWYOGI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|