About 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine
4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine (PubChem CID 116706684) has the molecular formula C15H24ClIN2O
and a molecular weight of 410.73 g/mol. Its IUPAC name is 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine |
| PubChem CID | 116706684 |
| Molecular Formula | C15H24ClIN2O |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine |
| SMILES | CCOC(c1nc(Cl)c(I)c(CC(C)C)n1)C(C)(C)C |
| InChI | InChI=1S/C15H24ClIN2O/c1-7-20-12(15(4,5)6)14-18-10(8-9(2)3)11(17)13(16)19-14/h9,12H,7-8H2,1-6H3 |
| InChIKey | PQKZPLRVGSRCFN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine?
The IUPAC name of 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine (CID 116706684) is 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine.
What is the SMILES notation for 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine?
The canonical SMILES for 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine is CCOC(c1nc(Cl)c(I)c(CC(C)C)n1)C(C)(C)C.
What is the InChIKey of 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine?
The InChIKey is PQKZPLRVGSRCFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24ClIN2O/c1-7-20-12(15(4,5)6)14-18-10(8-9(2)3)11(17)13(16)19-14/h9,12H,7-8H2,1-6H3.
What are the key properties of 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine?
4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine has a molecular weight of 410.73 g/mol, XLogP of 5.06, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(1-ethoxy-2,2-dimethylpropyl)-5-iodo-6-(2-methylpropyl)pyrimidine is sourced from PubChem (CID 116706684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).