C11H17NO2S — CID 116708274
3-methoxy-1-(4-methyl-1,3-thiazol-2-yl)hexan-2-one (PubChem CID 116708274) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-methoxy-1-(4-methyl-1,3-thiazol-2-yl)hexan-2-one.
| Compound Name | 3-methoxy-1-(4-methyl-1,3-thiazol-2-yl)hexan-2-one |
|---|---|
| PubChem CID | 116708274 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 3-methoxy-1-(4-methyl-1,3-thiazol-2-yl)hexan-2-one |
| SMILES | CCCC(OC)C(=O)Cc1nc(C)cs1 |
| InChI | InChI=1S/C11H17NO2S/c1-4-5-10(14-3)9(13)6-11-12-8(2)7-15-11/h7,10H,4-6H2,1-3H3 |
| InChIKey | JIJCATYNBMHNBM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |