C15H22O3 — CID 116709839
2-ethoxy-1-(3-methoxyphenyl)-3,3-dimethylbutan-1-one (PubChem CID 116709839) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-ethoxy-1-(3-methoxyphenyl)-3,3-dimethylbutan-1-one.
| Compound Name | 2-ethoxy-1-(3-methoxyphenyl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 116709839 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-ethoxy-1-(3-methoxyphenyl)-3,3-dimethylbutan-1-one |
| SMILES | CCOC(C(=O)c1cccc(OC)c1)C(C)(C)C |
| InChI | InChI=1S/C15H22O3/c1-6-18-14(15(2,3)4)13(16)11-8-7-9-12(10-11)17-5/h7-10,14H,6H2,1-5H3 |
| InChIKey | VKSSLEJTQIWOJC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |