C14H22O2 — CID 116711234
1-(2,5-dimethylphenyl)-2-ethoxybutan-1-ol (PubChem CID 116711234) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-ethoxybutan-1-ol.
| Compound Name | 1-(2,5-dimethylphenyl)-2-ethoxybutan-1-ol |
|---|---|
| PubChem CID | 116711234 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-ethoxybutan-1-ol |
| SMILES | CCOC(CC)C(O)c1cc(C)ccc1C |
| InChI | InChI=1S/C14H22O2/c1-5-13(16-6-2)14(15)12-9-10(3)7-8-11(12)4/h7-9,13-15H,5-6H2,1-4H3 |
| InChIKey | LLQREJYITYBHBJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |