C14H17F3O3 — CID 116712645
1-cyclopropyl-1-methoxy-3-[4-(trifluoromethoxy)phenyl]propan-2-ol (PubChem CID 116712645) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-cyclopropyl-1-methoxy-3-[4-(trifluoromethoxy)phenyl]propan-2-ol.
| Compound Name | 1-cyclopropyl-1-methoxy-3-[4-(trifluoromethoxy)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 116712645 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-cyclopropyl-1-methoxy-3-[4-(trifluoromethoxy)phenyl]propan-2-ol |
| SMILES | COC(C(O)Cc1ccc(OC(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C14H17F3O3/c1-19-13(10-4-5-10)12(18)8-9-2-6-11(7-3-9)20-14(15,16)17/h2-3,6-7,10,12-13,18H,4-5,8H2,1H3 |
| InChIKey | ZUPWPKLLOXICKI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |