C16H21F3O2 — CID 115787298
4-cyclopentyl-1-[4-(trifluoromethoxy)phenyl]butan-2-ol (PubChem CID 115787298) has the molecular formula C16H21F3O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 4-cyclopentyl-1-[4-(trifluoromethoxy)phenyl]butan-2-ol.
| Compound Name | 4-cyclopentyl-1-[4-(trifluoromethoxy)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 115787298 |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-cyclopentyl-1-[4-(trifluoromethoxy)phenyl]butan-2-ol |
| SMILES | OC(CCC1CCCC1)Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3O2/c17-16(18,19)21-15-9-6-13(7-10-15)11-14(20)8-5-12-3-1-2-4-12/h6-7,9-10,12,14,20H,1-5,8,11H2 |
| InChIKey | MHZUGMRPWGOVJP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |