C14H22BrNO2 — CID 116715439
1-(3-bromo-4-methoxyphenyl)-3-methoxy-N-methylpentan-2-amine (PubChem CID 116715439) has the molecular formula C14H22BrNO2 and a molecular weight of 316.24 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-3-methoxy-N-methylpentan-2-amine.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-3-methoxy-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 116715439 |
| Molecular Formula | C14H22BrNO2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-3-methoxy-N-methylpentan-2-amine |
| SMILES | CCC(OC)C(Cc1ccc(OC)c(Br)c1)NC |
| InChI | InChI=1S/C14H22BrNO2/c1-5-13(17-3)12(16-2)9-10-6-7-14(18-4)11(15)8-10/h6-8,12-13,16H,5,9H2,1-4H3 |
| InChIKey | FNMFIRJNCJMZFQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |