C31H43F3N4O5 — CID 11671664
N-[3-[(3aS)-5-(1-acetylpiperidine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 11671664) has the molecular formula C31H43F3N4O5 and a molecular weight of 608.70 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(1-acetylpiperidine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-[(3aS)-5-(1-acetylpiperidine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11671664 |
| Molecular Formula | C31H43F3N4O5 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | N-[3-[(3aS)-5-(1-acetylpiperidine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)N1CCC(C(=O)N2CC3CN(CCC(NC(=O)C4CCCC4)c4ccccc4)C[C@H]3C2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H42N4O3.C2HF3O2/c1-21(34)32-15-11-24(12-16-32)29(36)33-19-25-17-31(18-26(25)20-33)14-13-27(22-7-3-2-4-8-22)30-28(35)23-9-5-6-10-23;3-2(4,5)1(6)7/h2-4,7-8,23-27H,5-6,9-20H2,1H3,(H,30,35);(H,6,7)/t25-,26?,27?;/m0./s1 |
| InChIKey | XDWCNGPCPWEBLC-CQWZFICBSA-N |
| XLogP | 3.71 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |