C27H36F3N3O4 — CID 11685075
N-[3-[(3aS)-5-(cyclopropanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 11685075) has the molecular formula C27H36F3N3O4 and a molecular weight of 523.60 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(cyclopropanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-[(3aS)-5-(cyclopropanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11685075 |
| Molecular Formula | C27H36F3N3O4 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | N-[3-[(3aS)-5-(cyclopropanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC(CCN1CC2CN(C(=O)C3CC3)C[C@@H]2C1)c1ccccc1)C1CCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H35N3O2.C2HF3O2/c29-24(19-8-4-5-9-19)26-23(18-6-2-1-3-7-18)12-13-27-14-21-16-28(17-22(21)15-27)25(30)20-10-11-20;3-2(4,5)1(6)7/h1-3,6-7,19-23H,4-5,8-17H2,(H,26,29);(H,6,7)/t21-,22?,23?;/m0./s1 |
| InChIKey | GGPRJKVMHZYMSN-CVPHZBIISA-N |
| XLogP | 3.86 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |