C19H14F3I2N3O4 — CID 11671928
N-[(2S)-1-(cyanomethylamino)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 11671928) has the molecular formula C19H14F3I2N3O4 and a molecular weight of 659.14 g/mol. Its IUPAC name is N-[(2S)-1-(cyanomethylamino)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[(2S)-1-(cyanomethylamino)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 11671928 |
| Molecular Formula | C19H14F3I2N3O4 |
| Molecular Weight | 659.14 g/mol |
| Exact Mass | 658.90 |
| IUPAC Name | N-[(2S)-1-(cyanomethylamino)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | N#CCNC(=O)[C@H](Cc1cc(I)c(O)c(I)c1)NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F3I2N3O4/c20-19(21,22)31-12-3-1-11(2-4-12)17(29)27-15(18(30)26-6-5-25)9-10-7-13(23)16(28)14(24)8-10/h1-4,7-8,15,28H,6,9H2,(H,26,30)(H,27,29)/t15-/m0/s1 |
| InChIKey | UOFWFTLFDFLEAK-HNNXBMFYSA-N |
| XLogP | 3.48 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|