C13H13F3N4O3 — CID 90863717
N-(cyanomethyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propanamide (PubChem CID 90863717) has the molecular formula C13H13F3N4O3 and a molecular weight of 330.27 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propanamide.
| Compound Name | N-(cyanomethyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propanamide |
|---|---|
| PubChem CID | 90863717 |
| Molecular Formula | C13H13F3N4O3 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-(cyanomethyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propanamide |
| SMILES | CC(NC(=O)Nc1ccc(OC(F)(F)F)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C13H13F3N4O3/c1-8(11(21)18-7-6-17)19-12(22)20-9-2-4-10(5-3-9)23-13(14,15)16/h2-5,8H,7H2,1H3,(H,18,21)(H2,19,20,22) |
| InChIKey | WQORUWQNKPYQNE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|