C14H16F3N2O4- — CID 7562583
(2S)-4-methyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pentanoate (PubChem CID 7562583) has the molecular formula C14H16F3N2O4- and a molecular weight of 333.29 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pentanoate.
| Compound Name | (2S)-4-methyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pentanoate |
|---|---|
| PubChem CID | 7562583 |
| Molecular Formula | C14H16F3N2O4- |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (2S)-4-methyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)Nc1ccc(OC(F)(F)F)cc1)C(=O)[O-] |
| InChI | InChI=1S/C14H17F3N2O4/c1-8(2)7-11(12(20)21)19-13(22)18-9-3-5-10(6-4-9)23-14(15,16)17/h3-6,8,11H,7H2,1-2H3,(H,20,21)(H2,18,19,22)/p-1/t11-/m0/s1 |
| InChIKey | QMAHQQUXWLZAHB-NSHDSACASA-M |
| XLogP | 1.87 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |