C13H18F3N3O2 — CID 115564852
1-(1-aminopentan-3-yl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 115564852) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 1-(1-aminopentan-3-yl)-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(1-aminopentan-3-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 115564852 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-(1-aminopentan-3-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CCC(CCN)NC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3N3O2/c1-2-9(7-8-17)18-12(20)19-10-3-5-11(6-4-10)21-13(14,15)16/h3-6,9H,2,7-8,17H2,1H3,(H2,18,19,20) |
| InChIKey | XKWHWMJAKUXZTM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |