C18H26N2O — CID 116721300
3-ethoxy-N,4-dimethyl-1-quinolin-2-ylpentan-2-amine (PubChem CID 116721300) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-ethoxy-N,4-dimethyl-1-quinolin-2-ylpentan-2-amine.
| Compound Name | 3-ethoxy-N,4-dimethyl-1-quinolin-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 116721300 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-ethoxy-N,4-dimethyl-1-quinolin-2-ylpentan-2-amine |
| SMILES | CCOC(C(C)C)C(Cc1ccc2ccccc2n1)NC |
| InChI | InChI=1S/C18H26N2O/c1-5-21-18(13(2)3)17(19-4)12-15-11-10-14-8-6-7-9-16(14)20-15/h6-11,13,17-19H,5,12H2,1-4H3 |
| InChIKey | GNKONDGHVROHAU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |