C17H29NO — CID 116721264
1-(3,4-dimethylphenyl)-3-ethoxy-N,4-dimethylpentan-2-amine (PubChem CID 116721264) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-ethoxy-N,4-dimethylpentan-2-amine.
| Compound Name | 1-(3,4-dimethylphenyl)-3-ethoxy-N,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 116721264 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-ethoxy-N,4-dimethylpentan-2-amine |
| SMILES | CCOC(C(C)C)C(Cc1ccc(C)c(C)c1)NC |
| InChI | InChI=1S/C17H29NO/c1-7-19-17(12(2)3)16(18-6)11-15-9-8-13(4)14(5)10-15/h8-10,12,16-18H,7,11H2,1-6H3 |
| InChIKey | JBEBDALZDLKCII-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |