C18H31NO — CID 116721758
3-ethoxy-4-methyl-1-(3-methylphenyl)-N-propylpentan-2-amine (PubChem CID 116721758) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 3-ethoxy-4-methyl-1-(3-methylphenyl)-N-propylpentan-2-amine.
| Compound Name | 3-ethoxy-4-methyl-1-(3-methylphenyl)-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 116721758 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 3-ethoxy-4-methyl-1-(3-methylphenyl)-N-propylpentan-2-amine |
| SMILES | CCCNC(Cc1cccc(C)c1)C(OCC)C(C)C |
| InChI | InChI=1S/C18H31NO/c1-6-11-19-17(18(14(3)4)20-7-2)13-16-10-8-9-15(5)12-16/h8-10,12,14,17-19H,6-7,11,13H2,1-5H3 |
| InChIKey | HPVKJZVTCYZDOH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |