C11H17NO2 — CID 116723060
2-cyclopropyl-2-ethoxy-1-(furan-2-yl)ethanamine (PubChem CID 116723060) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-cyclopropyl-2-ethoxy-1-(furan-2-yl)ethanamine.
| Compound Name | 2-cyclopropyl-2-ethoxy-1-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 116723060 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-cyclopropyl-2-ethoxy-1-(furan-2-yl)ethanamine |
| SMILES | CCOC(C1CC1)C(N)c1ccco1 |
| InChI | InChI=1S/C11H17NO2/c1-2-13-11(8-5-6-8)10(12)9-4-3-7-14-9/h3-4,7-8,10-11H,2,5-6,12H2,1H3 |
| InChIKey | CWSHJXSDAJIJIB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |